C26H25FN2O5S — CID 69450964
(2S)-2-[[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 69450964) has the molecular formula C26H25FN2O5S and a molecular weight of 496.56 g/mol. Its IUPAC name is (2S)-2-[[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 69450964 |
| Molecular Formula | C26H25FN2O5S |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | (2S)-2-[[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(C2=C/C(=C3\C(=O)Nc4cc(F)ccc43)OC2(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C26H25FN2O5S/c1-26(2)18(13-21(34-26)22-17-9-8-16(27)12-20(17)29-24(22)31)14-4-6-15(7-5-14)23(30)28-19(25(32)33)10-11-35-3/h4-9,12-13,19H,10-11H2,1-3H3,(H,28,30)(H,29,31)(H,32,33)/b22-21+/t19-/m0/s1 |
| InChIKey | PFTKKCSHJDWWEQ-XJUMHSELSA-N |
| XLogP | 4.32 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|