C21H19FN2O4S — CID 58926002
N-[3-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]methanesulfonamide (PubChem CID 58926002) has the molecular formula C21H19FN2O4S and a molecular weight of 414.46 g/mol. Its IUPAC name is N-[3-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 58926002 |
| Molecular Formula | C21H19FN2O4S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[3-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]methanesulfonamide |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3cc(F)ccc32)C=C1c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H19FN2O4S/c1-21(2)16(12-5-4-6-14(9-12)24-29(3,26)27)11-18(28-21)19-15-8-7-13(22)10-17(15)23-20(19)25/h4-11,24H,1-3H3,(H,23,25)/b19-18+ |
| InChIKey | WCGJAAAORVIPLM-VHEBQXMUSA-N |
| XLogP | 3.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|