C14H11AlFNO2 — CID 149362037
CID 149362037 (PubChem CID 149362037) has the molecular formula C14H11AlFNO2 and a molecular weight of 271.23 g/mol.
| Compound Name | CID 149362037 |
|---|---|
| PubChem CID | 149362037 |
| Molecular Formula | C14H11AlFNO2 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | — |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3cc(F)ccc32)C=C1[Al] |
| InChI | InChI=1S/C14H11FNO2.Al/c1-14(2)6-5-11(18-14)12-9-4-3-8(15)7-10(9)16-13(12)17;/h3-5,7H,1-2H3,(H,16,17);/b12-11+; |
| InChIKey | VXLIBOKVVPHLKM-CALJPSDSSA-N |
| XLogP | 2.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|