C23H17FN2O2 — CID 58926432
(3E)-3-(5,5-dimethyl-4-quinolin-6-ylfuran-2-ylidene)-6-fluoro-1H-indol-2-one (PubChem CID 58926432) has the molecular formula C23H17FN2O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is (3E)-3-(5,5-dimethyl-4-quinolin-6-ylfuran-2-ylidene)-6-fluoro-1H-indol-2-one.
| Compound Name | (3E)-3-(5,5-dimethyl-4-quinolin-6-ylfuran-2-ylidene)-6-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 58926432 |
| Molecular Formula | C23H17FN2O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (3E)-3-(5,5-dimethyl-4-quinolin-6-ylfuran-2-ylidene)-6-fluoro-1H-indol-2-one |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3cc(F)ccc32)C=C1c1ccc2ncccc2c1 |
| InChI | InChI=1S/C23H17FN2O2/c1-23(2)17(13-5-8-18-14(10-13)4-3-9-25-18)12-20(28-23)21-16-7-6-15(24)11-19(16)26-22(21)27/h3-12H,1-2H3,(H,26,27)/b21-20+ |
| InChIKey | GUVGFBPKEYCFHD-QZQOTICOSA-N |
| XLogP | 4.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|