C24H18FNO4S — CID 69449106
methyl 5-[5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-1-benzothiophene-2-carboxylate (PubChem CID 69449106) has the molecular formula C24H18FNO4S and a molecular weight of 435.48 g/mol. Its IUPAC name is methyl 5-[5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-[5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 69449106 |
| Molecular Formula | C24H18FNO4S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | methyl 5-[5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(C3=CC(=C4C(=O)Nc5cc(F)ccc54)OC3(C)C)ccc2s1 |
| InChI | InChI=1S/C24H18FNO4S/c1-24(2)16(12-4-7-19-13(8-12)9-20(31-19)23(28)29-3)11-18(30-24)21-15-6-5-14(25)10-17(15)26-22(21)27/h4-11H,1-3H3,(H,26,27) |
| InChIKey | AXQIBTAXMCIKOF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|