C24H22FNO4 — CID 69449539
methyl 3-[3-[5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]propanoate (PubChem CID 69449539) has the molecular formula C24H22FNO4 and a molecular weight of 407.44 g/mol. Its IUPAC name is methyl 3-[3-[5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]propanoate.
| Compound Name | methyl 3-[3-[5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 69449539 |
| Molecular Formula | C24H22FNO4 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | methyl 3-[3-[5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]propanoate |
| SMILES | COC(=O)CCc1cccc(C2=CC(=C3C(=O)Nc4cc(F)ccc43)OC2(C)C)c1 |
| InChI | InChI=1S/C24H22FNO4/c1-24(2)18(15-6-4-5-14(11-15)7-10-21(27)29-3)13-20(30-24)22-17-9-8-16(25)12-19(17)26-23(22)28/h4-6,8-9,11-13H,7,10H2,1-3H3,(H,26,28) |
| InChIKey | XYQCNKNKNCILFP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|