C25H26FN3O2 — CID 123838875
3-[5,5-dimethyl-4-[4-(piperazin-1-ylmethyl)phenyl]furan-2-ylidene]-6-fluoro-1H-indol-2-one (PubChem CID 123838875) has the molecular formula C25H26FN3O2 and a molecular weight of 419.50 g/mol. Its IUPAC name is 3-[5,5-dimethyl-4-[4-(piperazin-1-ylmethyl)phenyl]furan-2-ylidene]-6-fluoro-1H-indol-2-one.
| Compound Name | 3-[5,5-dimethyl-4-[4-(piperazin-1-ylmethyl)phenyl]furan-2-ylidene]-6-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 123838875 |
| Molecular Formula | C25H26FN3O2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 3-[5,5-dimethyl-4-[4-(piperazin-1-ylmethyl)phenyl]furan-2-ylidene]-6-fluoro-1H-indol-2-one |
| SMILES | CC1(C)OC(=C2C(=O)Nc3cc(F)ccc32)C=C1c1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C25H26FN3O2/c1-25(2)20(17-5-3-16(4-6-17)15-29-11-9-27-10-12-29)14-22(31-25)23-19-8-7-18(26)13-21(19)28-24(23)30/h3-8,13-14,27H,9-12,15H2,1-2H3,(H,28,30) |
| InChIKey | VKVNLHQRPKTIGD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|