C24H24FN3O3 — CID 58926118
(3E)-6-fluoro-3-[4-[2-(4-hydroxypiperidin-1-yl)-4-pyridinyl]-5,5-dimethylfuran-2-ylidene]-1H-indol-2-one (PubChem CID 58926118) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is (3E)-6-fluoro-3-[4-[2-(4-hydroxypiperidin-1-yl)-4-pyridinyl]-5,5-dimethylfuran-2-ylidene]-1H-indol-2-one.
| Compound Name | (3E)-6-fluoro-3-[4-[2-(4-hydroxypiperidin-1-yl)-4-pyridinyl]-5,5-dimethylfuran-2-ylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 58926118 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (3E)-6-fluoro-3-[4-[2-(4-hydroxypiperidin-1-yl)-4-pyridinyl]-5,5-dimethylfuran-2-ylidene]-1H-indol-2-one |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3cc(F)ccc32)C=C1c1ccnc(N2CCC(O)CC2)c1 |
| InChI | InChI=1S/C24H24FN3O3/c1-24(2)18(14-5-8-26-21(11-14)28-9-6-16(29)7-10-28)13-20(31-24)22-17-4-3-15(25)12-19(17)27-23(22)30/h3-5,8,11-13,16,29H,6-7,9-10H2,1-2H3,(H,27,30)/b22-20+ |
| InChIKey | RLINJOVMUVRXBI-LSDHQDQOSA-N |
| XLogP | 3.74 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|