C22H18FNO4 — CID 58926190
methyl 3-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]benzoate (PubChem CID 58926190) has the molecular formula C22H18FNO4 and a molecular weight of 379.39 g/mol. Its IUPAC name is methyl 3-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]benzoate.
| Compound Name | methyl 3-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]benzoate |
|---|---|
| PubChem CID | 58926190 |
| Molecular Formula | C22H18FNO4 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | methyl 3-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]benzoate |
| SMILES | COC(=O)c1cccc(C2=C/C(=C3\C(=O)Nc4cc(F)ccc43)OC2(C)C)c1 |
| InChI | InChI=1S/C22H18FNO4/c1-22(2)16(12-5-4-6-13(9-12)21(26)27-3)11-18(28-22)19-15-8-7-14(23)10-17(15)24-20(19)25/h4-11H,1-3H3,(H,24,25)/b19-18+ |
| InChIKey | UFWSVPUASLGPGE-VHEBQXMUSA-N |
| XLogP | 4.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|