C19H16FN3O2 — CID 129158319
(3E)-3-[4-(6-amino-3-pyridinyl)-5,5-dimethylfuran-2-ylidene]-5-fluoro-1H-indol-2-one (PubChem CID 129158319) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is (3E)-3-[4-(6-amino-3-pyridinyl)-5,5-dimethylfuran-2-ylidene]-5-fluoro-1H-indol-2-one.
| Compound Name | (3E)-3-[4-(6-amino-3-pyridinyl)-5,5-dimethylfuran-2-ylidene]-5-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 129158319 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (3E)-3-[4-(6-amino-3-pyridinyl)-5,5-dimethylfuran-2-ylidene]-5-fluoro-1H-indol-2-one |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3ccc(F)cc32)C=C1c1ccc(N)nc1 |
| InChI | InChI=1S/C19H16FN3O2/c1-19(2)13(10-3-6-16(21)22-9-10)8-15(25-19)17-12-7-11(20)4-5-14(12)23-18(17)24/h3-9H,1-2H3,(H2,21,22)(H,23,24)/b17-15+ |
| InChIKey | TYDPZDYZOVSTSG-BMRADRMJSA-N |
| XLogP | 3.36 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|