C12H7AlFNO2 — CID 147616014
CID 147616014 (PubChem CID 147616014) has the molecular formula C12H7AlFNO2 and a molecular weight of 243.17 g/mol.
| Compound Name | CID 147616014 |
|---|---|
| PubChem CID | 147616014 |
| Molecular Formula | C12H7AlFNO2 |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | — |
| SMILES | O=C1Nc2cc(F)ccc2/C1=C1/C=C([Al])CO1 |
| InChI | InChI=1S/C12H7FNO2.Al/c13-7-3-4-8-9(6-7)14-12(15)11(8)10-2-1-5-16-10;/h2-4,6H,5H2,(H,14,15);/b11-10+; |
| InChIKey | CUCFTHMPVAKNGB-ASTDGNLGSA-N |
| XLogP | 1.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|