C18H15FN2O3 — CID 10245816
(3E)-6-fluoro-3-[5-(2-hydroxyethylamino)-3H-2-benzofuran-1-ylidene]-1H-indol-2-one (PubChem CID 10245816) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is (3E)-6-fluoro-3-[5-(2-hydroxyethylamino)-3H-2-benzofuran-1-ylidene]-1H-indol-2-one.
| Compound Name | (3E)-6-fluoro-3-[5-(2-hydroxyethylamino)-3H-2-benzofuran-1-ylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 10245816 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (3E)-6-fluoro-3-[5-(2-hydroxyethylamino)-3H-2-benzofuran-1-ylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2/C1=C1\OCc2cc(NCCO)ccc21 |
| InChI | InChI=1S/C18H15FN2O3/c19-11-1-3-14-15(8-11)21-18(23)16(14)17-13-4-2-12(20-5-6-22)7-10(13)9-24-17/h1-4,7-8,20,22H,5-6,9H2,(H,21,23)/b17-16+ |
| InChIKey | LDMNDPIDZZQFCT-WUKNDPDISA-N |
| XLogP | 2.58 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|