C17H10FNO4 — CID 58586290
(1E)-1-(6-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-carboxylic acid (PubChem CID 58586290) has the molecular formula C17H10FNO4 and a molecular weight of 311.27 g/mol. Its IUPAC name is (1E)-1-(6-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-carboxylic acid.
| Compound Name | (1E)-1-(6-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 58586290 |
| Molecular Formula | C17H10FNO4 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (1E)-1-(6-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-carboxylic acid |
| SMILES | O=C1Nc2cc(F)ccc2/C1=C1\OCc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C17H10FNO4/c18-10-2-4-12-13(6-10)19-16(20)14(12)15-11-3-1-8(17(21)22)5-9(11)7-23-15/h1-6H,7H2,(H,19,20)(H,21,22)/b15-14+ |
| InChIKey | GQHGHLNMYZZUKE-CCEZHUSRSA-N |
| XLogP | 2.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|