C12H7BrFNO2 — CID 58926075
(3E)-3-(3-bromo-2H-furan-5-ylidene)-6-fluoro-1H-indol-2-one (PubChem CID 58926075) has the molecular formula C12H7BrFNO2 and a molecular weight of 296.10 g/mol. Its IUPAC name is (3E)-3-(3-bromo-2H-furan-5-ylidene)-6-fluoro-1H-indol-2-one.
| Compound Name | (3E)-3-(3-bromo-2H-furan-5-ylidene)-6-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 58926075 |
| Molecular Formula | C12H7BrFNO2 |
| Molecular Weight | 296.10 g/mol |
| Exact Mass | 294.96 |
| IUPAC Name | (3E)-3-(3-bromo-2H-furan-5-ylidene)-6-fluoro-1H-indol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2/C1=C1/C=C(Br)CO1 |
| InChI | InChI=1S/C12H7BrFNO2/c13-6-3-10(17-5-6)11-8-2-1-7(14)4-9(8)15-12(11)16/h1-4H,5H2,(H,15,16)/b11-10+ |
| InChIKey | GGFSEDPJSLWIEB-ZHACJKMWSA-N |
| XLogP | 2.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.10 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|