C19H12FNO4 — CID 69449557
3-[3-(1,3-benzodioxol-5-yl)-2H-furan-5-ylidene]-6-fluoro-1H-indol-2-one (PubChem CID 69449557) has the molecular formula C19H12FNO4 and a molecular weight of 337.31 g/mol. Its IUPAC name is 3-[3-(1,3-benzodioxol-5-yl)-2H-furan-5-ylidene]-6-fluoro-1H-indol-2-one.
| Compound Name | 3-[3-(1,3-benzodioxol-5-yl)-2H-furan-5-ylidene]-6-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 69449557 |
| Molecular Formula | C19H12FNO4 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-[3-(1,3-benzodioxol-5-yl)-2H-furan-5-ylidene]-6-fluoro-1H-indol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2C1=C1C=C(c2ccc3c(c2)OCO3)CO1 |
| InChI | InChI=1S/C19H12FNO4/c20-12-2-3-13-14(7-12)21-19(22)18(13)17-6-11(8-23-17)10-1-4-15-16(5-10)25-9-24-15/h1-7H,8-9H2,(H,21,22) |
| InChIKey | NLTAJNGKJQQKET-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|