C16H17FN2O3 — CID 69420324
6-fluoro-3-[3-[2-methoxyethyl(methyl)amino]-2H-furan-5-ylidene]-1H-indol-2-one (PubChem CID 69420324) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is 6-fluoro-3-[3-[2-methoxyethyl(methyl)amino]-2H-furan-5-ylidene]-1H-indol-2-one.
| Compound Name | 6-fluoro-3-[3-[2-methoxyethyl(methyl)amino]-2H-furan-5-ylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 69420324 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 6-fluoro-3-[3-[2-methoxyethyl(methyl)amino]-2H-furan-5-ylidene]-1H-indol-2-one |
| SMILES | COCCN(C)C1=CC(=C2C(=O)Nc3cc(F)ccc32)OC1 |
| InChI | InChI=1S/C16H17FN2O3/c1-19(5-6-21-2)11-8-14(22-9-11)15-12-4-3-10(17)7-13(12)18-16(15)20/h3-4,7-8H,5-6,9H2,1-2H3,(H,18,20) |
| InChIKey | YBAZFCRKJNKUFL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|