C23H20FNO6 — CID 91283881
4-[3-[1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]propoxy]-4-oxobutanoic acid (PubChem CID 91283881) has the molecular formula C23H20FNO6 and a molecular weight of 425.41 g/mol. Its IUPAC name is 4-[3-[1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]propoxy]-4-oxobutanoic acid.
| Compound Name | 4-[3-[1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]propoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91283881 |
| Molecular Formula | C23H20FNO6 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 4-[3-[1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]propoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OCCCc1ccc2c(c1)COC2=C1C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C23H20FNO6/c24-15-4-6-18-17(11-15)21(23(29)25-18)22-16-5-3-13(10-14(16)12-31-22)2-1-9-30-20(28)8-7-19(26)27/h3-6,10-11H,1-2,7-9,12H2,(H,25,29)(H,26,27) |
| InChIKey | RZTQSKCTIPZFGZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|