C24H27FN2O5 — CID 161421882
(2S,3R)-2-[2-[(1E)-1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethylamino]-3-methoxybutanoic acid;methane (PubChem CID 161421882) has the molecular formula C24H27FN2O5 and a molecular weight of 442.49 g/mol. Its IUPAC name is (2S,3R)-2-[2-[(1E)-1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethylamino]-3-methoxybutanoic acid;methane.
| Compound Name | (2S,3R)-2-[2-[(1E)-1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethylamino]-3-methoxybutanoic acid;methane |
|---|---|
| PubChem CID | 161421882 |
| Molecular Formula | C24H27FN2O5 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (2S,3R)-2-[2-[(1E)-1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethylamino]-3-methoxybutanoic acid;methane |
| SMILES | C.CO[C@H](C)[C@H](NCCc1ccc2c(c1)CO/C2=C1/C(=O)Nc2ccc(F)cc21)C(=O)O |
| InChI | InChI=1S/C23H23FN2O5.CH4/c1-12(30-2)20(23(28)29)25-8-7-13-3-5-16-14(9-13)11-31-21(16)19-17-10-15(24)4-6-18(17)26-22(19)27;/h3-6,9-10,12,20,25H,7-8,11H2,1-2H3,(H,26,27)(H,28,29);1H4/b21-19+;/t12-,20+;/m1./s1 |
| InChIKey | VWVMCBITAVXHGY-IRJNJRKLSA-N |
| XLogP | 3.43 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|