C26H29FN2O4 — CID 161016921
ethyl (2S)-1-[2-[(1E)-1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethyl]pyrrolidine-2-carboxylate;methane (PubChem CID 161016921) has the molecular formula C26H29FN2O4 and a molecular weight of 452.53 g/mol. Its IUPAC name is ethyl (2S)-1-[2-[(1E)-1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethyl]pyrrolidine-2-carboxylate;methane.
| Compound Name | ethyl (2S)-1-[2-[(1E)-1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethyl]pyrrolidine-2-carboxylate;methane |
|---|---|
| PubChem CID | 161016921 |
| Molecular Formula | C26H29FN2O4 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | ethyl (2S)-1-[2-[(1E)-1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethyl]pyrrolidine-2-carboxylate;methane |
| SMILES | C.CCOC(=O)[C@@H]1CCCN1CCc1ccc2c(c1)CO/C2=C1/C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C25H25FN2O4.CH4/c1-2-31-25(30)21-4-3-10-28(21)11-9-15-5-7-18-16(12-15)14-32-23(18)22-19-13-17(26)6-8-20(19)27-24(22)29;/h5-8,12-13,21H,2-4,9-11,14H2,1H3,(H,27,29);1H4/b23-22+;/t21-;/m0./s1 |
| InChIKey | TXVQMANQEHRSGP-OOXITOQKSA-N |
| XLogP | 4.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|