C25H26N2O4 — CID 68994260
ethyl 1-[[1-(2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]methyl]piperidine-3-carboxylate (PubChem CID 68994260) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is ethyl 1-[[1-(2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[[1-(2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 68994260 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | ethyl 1-[[1-(2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cc2ccc3c(c2)COC3=C2C(=O)Nc3ccccc32)C1 |
| InChI | InChI=1S/C25H26N2O4/c1-2-30-25(29)17-6-5-11-27(14-17)13-16-9-10-19-18(12-16)15-31-23(19)22-20-7-3-4-8-21(20)26-24(22)28/h3-4,7-10,12,17H,2,5-6,11,13-15H2,1H3,(H,26,28) |
| InChIKey | AYUPPILBLFIHNI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|