C22H24N2O2 — CID 16618079
ethyl 1-[[4-(2-cyanophenyl)phenyl]methyl]piperidine-3-carboxylate (PubChem CID 16618079) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is ethyl 1-[[4-(2-cyanophenyl)phenyl]methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[[4-(2-cyanophenyl)phenyl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 16618079 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | ethyl 1-[[4-(2-cyanophenyl)phenyl]methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cc2ccc(-c3ccccc3C#N)cc2)C1 |
| InChI | InChI=1S/C22H24N2O2/c1-2-26-22(25)20-7-5-13-24(16-20)15-17-9-11-18(12-10-17)21-8-4-3-6-19(21)14-23/h3-4,6,8-12,20H,2,5,7,13,15-16H2,1H3 |
| InChIKey | ZNLFBRMABXXWFC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |