C16H20N2O2 — CID 40800844
ethyl (3R)-1-[(4-cyanophenyl)methyl]piperidine-3-carboxylate (PubChem CID 40800844) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is ethyl (3R)-1-[(4-cyanophenyl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(4-cyanophenyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 40800844 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | ethyl (3R)-1-[(4-cyanophenyl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(Cc2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C16H20N2O2/c1-2-20-16(19)15-4-3-9-18(12-15)11-14-7-5-13(10-17)6-8-14/h5-8,15H,2-4,9,11-12H2,1H3/t15-/m1/s1 |
| InChIKey | NZFOYEOTOJYWEA-OAHLLOKOSA-N |
| XLogP | 2.33 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |