C16H20F3NO2 — CID 2838402
ethyl 1-[[4-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylate (PubChem CID 2838402) has the molecular formula C16H20F3NO2 and a molecular weight of 315.34 g/mol. Its IUPAC name is ethyl 1-[[4-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[[4-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 2838402 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | ethyl 1-[[4-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C16H20F3NO2/c1-2-22-15(21)13-4-3-9-20(11-13)10-12-5-7-14(8-6-12)16(17,18)19/h5-8,13H,2-4,9-11H2,1H3 |
| InChIKey | LFLRPHTYKDQUGX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |