C17H21F3N2O3 — CID 4525369
ethyl 1-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]piperidine-3-carboxylate (PubChem CID 4525369) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is ethyl 1-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 4525369 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | ethyl 1-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(CC(=O)Nc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C17H21F3N2O3/c1-2-25-16(24)12-4-3-9-22(10-12)11-15(23)21-14-7-5-13(6-8-14)17(18,19)20/h5-8,12H,2-4,9-11H2,1H3,(H,21,23) |
| InChIKey | OSQXPKQCJYGLLK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |