C17H20ClF3N2O3 — CID 16554734
ethyl 1-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]piperidine-3-carboxylate (PubChem CID 16554734) has the molecular formula C17H20ClF3N2O3 and a molecular weight of 392.81 g/mol. Its IUPAC name is ethyl 1-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 16554734 |
| Molecular Formula | C17H20ClF3N2O3 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | ethyl 1-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(CC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H20ClF3N2O3/c1-2-26-16(25)11-4-3-7-23(9-11)10-15(24)22-12-5-6-14(18)13(8-12)17(19,20)21/h5-6,8,11H,2-4,7,9-10H2,1H3,(H,22,24) |
| InChIKey | FAPTZPOJNQIREI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |