About ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile
ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile (PubChem CID 143159635) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile.
Molecular Properties
| Compound Name | ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile |
| PubChem CID | 143159635 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile |
| SMILES | C#N.CCOC(=O)C1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H19NO2.CHN/c1-2-17-14(16)13-8-9-15(11-13)10-12-6-4-3-5-7-12;1-2/h3-7,13H,2,8-11H2,1H3;1H |
| InChIKey | HMOAMNDWUYZSQO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile?
The IUPAC name of ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile (CID 143159635) is ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile.
What is the SMILES notation for ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile?
The canonical SMILES for ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile is C#N.CCOC(=O)C1CCN(Cc2ccccc2)C1.
What is the InChIKey of ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile?
The InChIKey is HMOAMNDWUYZSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2.CHN/c1-2-17-14(16)13-8-9-15(11-13)10-12-6-4-3-5-7-12;1-2/h3-7,13H,2,8-11H2,1H3;1H.
What are the key properties of ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile?
ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile has a molecular weight of 260.34 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-benzylpyrrolidine-3-carboxylate;formonitrile is sourced from PubChem (CID 143159635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).