C15H24Cl2N2O2 — CID 155921053
ethyl (3S,4S)-3-amino-1-benzylpiperidine-4-carboxylate;dihydrochloride (PubChem CID 155921053) has the molecular formula C15H24Cl2N2O2 and a molecular weight of 335.28 g/mol. Its IUPAC name is ethyl (3S,4S)-3-amino-1-benzylpiperidine-4-carboxylate;dihydrochloride.
| Compound Name | ethyl (3S,4S)-3-amino-1-benzylpiperidine-4-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 155921053 |
| Molecular Formula | C15H24Cl2N2O2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | ethyl (3S,4S)-3-amino-1-benzylpiperidine-4-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)[C@H]1CCN(Cc2ccccc2)C[C@H]1N.Cl.Cl |
| InChI | InChI=1S/C15H22N2O2.2ClH/c1-2-19-15(18)13-8-9-17(11-14(13)16)10-12-6-4-3-5-7-12;;/h3-7,13-14H,2,8-11,16H2,1H3;2*1H/t13-,14+;;/m0../s1 |
| InChIKey | ZQEIWTCKPHMDLI-WICJZZOFSA-N |
| XLogP | 2.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |