C22H25NO4 — CID 155095649
3-O-benzyl 4-O-ethyl (3S,4S)-1-benzylpyrrolidine-3,4-dicarboxylate (PubChem CID 155095649) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is 3-O-benzyl 4-O-ethyl (3S,4S)-1-benzylpyrrolidine-3,4-dicarboxylate.
| Compound Name | 3-O-benzyl 4-O-ethyl (3S,4S)-1-benzylpyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 155095649 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 3-O-benzyl 4-O-ethyl (3S,4S)-1-benzylpyrrolidine-3,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(Cc2ccccc2)C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H25NO4/c1-2-26-21(24)19-14-23(13-17-9-5-3-6-10-17)15-20(19)22(25)27-16-18-11-7-4-8-12-18/h3-12,19-20H,2,13-16H2,1H3/t19-,20-/m1/s1 |
| InChIKey | VAPHPGAWDQAHSL-WOJBJXKFSA-N |
| XLogP | 3.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |