C22H23F2NO4 — CID 24998025
dibenzyl (3S,4S)-1-(2,2-difluoroethyl)pyrrolidine-3,4-dicarboxylate (PubChem CID 24998025) has the molecular formula C22H23F2NO4 and a molecular weight of 403.43 g/mol. Its IUPAC name is dibenzyl (3S,4S)-1-(2,2-difluoroethyl)pyrrolidine-3,4-dicarboxylate.
| Compound Name | dibenzyl (3S,4S)-1-(2,2-difluoroethyl)pyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 24998025 |
| Molecular Formula | C22H23F2NO4 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | dibenzyl (3S,4S)-1-(2,2-difluoroethyl)pyrrolidine-3,4-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1CN(CC(F)F)C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H23F2NO4/c23-20(24)13-25-11-18(21(26)28-14-16-7-3-1-4-8-16)19(12-25)22(27)29-15-17-9-5-2-6-10-17/h1-10,18-20H,11-15H2/t18-,19-/m1/s1 |
| InChIKey | RVKLGPRIQSEIFL-RTBURBONSA-N |
| XLogP | 3.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |