C25H29NO4 — CID 164643868
dibenzyl (3S,4S)-1-cyclopentylpyrrolidine-3,4-dicarboxylate (PubChem CID 164643868) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is dibenzyl (3S,4S)-1-cyclopentylpyrrolidine-3,4-dicarboxylate.
| Compound Name | dibenzyl (3S,4S)-1-cyclopentylpyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 164643868 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | dibenzyl (3S,4S)-1-cyclopentylpyrrolidine-3,4-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1CN(C2CCCC2)C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H29NO4/c27-24(29-17-19-9-3-1-4-10-19)22-15-26(21-13-7-8-14-21)16-23(22)25(28)30-18-20-11-5-2-6-12-20/h1-6,9-12,21-23H,7-8,13-18H2/t22-,23-/m1/s1 |
| InChIKey | NJSFBZQCWZUHRO-DHIUTWEWSA-N |
| XLogP | 3.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |