C17H17NO4 — CID 66881534
trans-benzyl (1S,2S)-2-(2,5-dioxopyrrol-1-yl)cyclopentane-1-carboxylate (PubChem CID 66881534) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is trans-benzyl (1S,2S)-2-(2,5-dioxopyrrol-1-yl)cyclopentane-1-carboxylate.
| Compound Name | trans-benzyl (1S,2S)-2-(2,5-dioxopyrrol-1-yl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 66881534 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | trans-benzyl (1S,2S)-2-(2,5-dioxopyrrol-1-yl)cyclopentane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1CCC[C@@H]1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H17NO4/c19-15-9-10-16(20)18(15)14-8-4-7-13(14)17(21)22-11-12-5-2-1-3-6-12/h1-3,5-6,9-10,13-14H,4,7-8,11H2/t13-,14-/m0/s1 |
| InChIKey | YXTWTVAFRNKNHZ-KBPBESRZSA-N |
| XLogP | 1.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|