C19H24O6 — CID 129196194
1-O-benzyl 2-O-(2-hydroxy-2-methylpropanoyl) cyclohexane-1,2-dicarboxylate (PubChem CID 129196194) has the molecular formula C19H24O6 and a molecular weight of 348.39 g/mol. Its IUPAC name is 1-O-benzyl 2-O-(2-hydroxy-2-methylpropanoyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-(2-hydroxy-2-methylpropanoyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 129196194 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-O-benzyl 2-O-(2-hydroxy-2-methylpropanoyl) cyclohexane-1,2-dicarboxylate |
| SMILES | CC(C)(O)C(=O)OC(=O)C1CCCCC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H24O6/c1-19(2,23)18(22)25-17(21)15-11-7-6-10-14(15)16(20)24-12-13-8-4-3-5-9-13/h3-5,8-9,14-15,23H,6-7,10-12H2,1-2H3 |
| InChIKey | XLFBOOITGLOVRO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|