C13H14F2O2 — CID 175348269
benzyl 2-(1,1-difluoroethyl)cyclopropane-1-carboxylate (PubChem CID 175348269) has the molecular formula C13H14F2O2 and a molecular weight of 240.25 g/mol. Its IUPAC name is benzyl 2-(1,1-difluoroethyl)cyclopropane-1-carboxylate.
| Compound Name | benzyl 2-(1,1-difluoroethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 175348269 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | benzyl 2-(1,1-difluoroethyl)cyclopropane-1-carboxylate |
| SMILES | CC(F)(F)C1CC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H14F2O2/c1-13(14,15)11-7-10(11)12(16)17-8-9-5-3-2-4-6-9/h2-6,10-11H,7-8H2,1H3 |
| InChIKey | MSEKITBTLPJWOI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |