C12H9F5O3 — CID 102421799
benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate (PubChem CID 102421799) has the molecular formula C12H9F5O3 and a molecular weight of 296.19 g/mol. Its IUPAC name is benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate.
| Compound Name | benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 102421799 |
| Molecular Formula | C12H9F5O3 |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1OC1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F5O3/c13-11(14,12(15,16)17)9-8(20-9)10(18)19-6-7-4-2-1-3-5-7/h1-5,8-9H,6H2 |
| InChIKey | HWBLWWCJYDQSEV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|