benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate

C12H9F5O3 — CID 102421799

IUPACbenzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate
SMILESO=C(OCc1ccccc1)C1OC1C(F)(F)C(F)(F)F
InChIInChI=1S/C12H9F5O3/c13-11(14,12(15,16)17)9-8(20-9)10(18)19-6-7-4-2-1-3-5-7/h1-5,8-9H,6H2
InChIKeyHWBLWWCJYDQSEV-UHFFFAOYSA-N
MW296.19 g/mol
LogP2.69
Rot. Bonds4

About benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate

benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate (PubChem CID 102421799) has the molecular formula C12H9F5O3 and a molecular weight of 296.19 g/mol. Its IUPAC name is benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate.

Molecular Properties

Compound Namebenzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate
PubChem CID102421799
Molecular FormulaC12H9F5O3
Molecular Weight296.19 g/mol
Exact Mass296.05
IUPAC Namebenzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate
SMILESO=C(OCc1ccccc1)C1OC1C(F)(F)C(F)(F)F
InChIInChI=1S/C12H9F5O3/c13-11(14,12(15,16)17)9-8(20-9)10(18)19-6-7-4-2-1-3-5-7/h1-5,8-9H,6H2
InChIKeyHWBLWWCJYDQSEV-UHFFFAOYSA-N
XLogP2.69
TPSA38.83 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.19
LogP ≤ 52.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate?
The IUPAC name of benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate (CID 102421799) is benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate.
What is the SMILES notation for benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate?
The canonical SMILES for benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate is O=C(OCc1ccccc1)C1OC1C(F)(F)C(F)(F)F.
What is the InChIKey of benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate?
The InChIKey is HWBLWWCJYDQSEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F5O3/c13-11(14,12(15,16)17)9-8(20-9)10(18)19-6-7-4-2-1-3-5-7/h1-5,8-9H,6H2.
What are the key properties of benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate?
benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate has a molecular weight of 296.19 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-(1,1,2,2,2-pentafluoroethyl)oxirane-2-carboxylate is sourced from PubChem (CID 102421799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).