C22H20O5 — CID 23520450
dibenzyl 7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 23520450) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is dibenzyl 7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dibenzyl 7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 23520450 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | dibenzyl 7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)C1C2C=CC(O2)C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H20O5/c23-21(25-13-15-7-3-1-4-8-15)19-17-11-12-18(27-17)20(19)22(24)26-14-16-9-5-2-6-10-16/h1-12,17-20H,13-14H2 |
| InChIKey | KWZHRUVMNWZKEX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|