C23H20F2O4 — CID 102110796
dibenzyl (2R,3S)-7,7-difluorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 102110796) has the molecular formula C23H20F2O4 and a molecular weight of 398.41 g/mol. Its IUPAC name is dibenzyl (2R,3S)-7,7-difluorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dibenzyl (2R,3S)-7,7-difluorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102110796 |
| Molecular Formula | C23H20F2O4 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | dibenzyl (2R,3S)-7,7-difluorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1C2C=CC([C@@H]1C(=O)OCc1ccccc1)C2(F)F |
| InChI | InChI=1S/C23H20F2O4/c24-23(25)17-11-12-18(23)20(22(27)29-14-16-9-5-2-6-10-16)19(17)21(26)28-13-15-7-3-1-4-8-15/h1-12,17-20H,13-14H2/t17?,18?,19-,20+ |
| InChIKey | SZBNRVVWVMAYQI-KHSMEXAKSA-N |
| XLogP | 4.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|