C16H16O4 — CID 800670
(1R,2S,3S,4S)-3-phenylmethoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 800670) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is (1R,2S,3S,4S)-3-phenylmethoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3S,4S)-3-phenylmethoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 800670 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (1R,2S,3S,4S)-3-phenylmethoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(OCc1ccccc1)[C@@H]1[C@@H](C(=O)O)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C16H16O4/c17-15(18)13-11-6-7-12(8-11)14(13)16(19)20-9-10-4-2-1-3-5-10/h1-7,11-14H,8-9H2,(H,17,18)/t11-,12+,13-,14-/m0/s1 |
| InChIKey | ZYHNWUUZQVZDNM-CRWXNKLISA-N |
| XLogP | 2.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|