C16H14Cl2O4 — CID 98153970
(1R,2S,3S,4R)-3-[(2,6-dichlorophenyl)methoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98153970) has the molecular formula C16H14Cl2O4 and a molecular weight of 341.19 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-[(2,6-dichlorophenyl)methoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3S,4R)-3-[(2,6-dichlorophenyl)methoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98153970 |
| Molecular Formula | C16H14Cl2O4 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (1R,2S,3S,4R)-3-[(2,6-dichlorophenyl)methoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](C(=O)OCc2c(Cl)cccc2Cl)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C16H14Cl2O4/c17-11-2-1-3-12(18)10(11)7-22-16(21)14-9-5-4-8(6-9)13(14)15(19)20/h1-5,8-9,13-14H,6-7H2,(H,19,20)/t8-,9-,13-,14-/m0/s1 |
| InChIKey | YPNISUUULPSERE-WBRVRECLSA-N |
| XLogP | 3.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|