C23H23NO4 — CID 101268069
benzyl (1S,2S,3R,4R)-3-(phenylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 101268069) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is benzyl (1S,2S,3R,4R)-3-(phenylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | benzyl (1S,2S,3R,4R)-3-(phenylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101268069 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | benzyl (1S,2S,3R,4R)-3-(phenylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(N[C@H]1[C@@H](C(=O)OCc2ccccc2)[C@@H]2C=C[C@H]1C2)OCc1ccccc1 |
| InChI | InChI=1S/C23H23NO4/c25-22(27-14-16-7-3-1-4-8-16)20-18-11-12-19(13-18)21(20)24-23(26)28-15-17-9-5-2-6-10-17/h1-12,18-21H,13-15H2,(H,24,26)/t18-,19+,20+,21-/m1/s1 |
| InChIKey | VJCDPIYKLLITCN-IVAOSVALSA-N |
| XLogP | 3.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|