C17H19NO4 — CID 59847813
methyl (1S,4R)-3-(phenylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 59847813) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl (1S,4R)-3-(phenylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1S,4R)-3-(phenylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 59847813 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl (1S,4R)-3-(phenylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COC(=O)C1C(NC(=O)OCc2ccccc2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C17H19NO4/c1-21-16(19)14-12-7-8-13(9-12)15(14)18-17(20)22-10-11-5-3-2-4-6-11/h2-8,12-15H,9-10H2,1H3,(H,18,20)/t12-,13+,14?,15?/m1/s1 |
| InChIKey | XPHCXUYYBOKPDX-DNDYEEKYSA-N |
| XLogP | 2.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|