C18H22N2O3 — CID 75507587
benzyl N-[(2R,3R)-3-(dimethylcarbamoyl)-2-bicyclo[2.2.1]hept-5-enyl]carbamate (PubChem CID 75507587) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is benzyl N-[(2R,3R)-3-(dimethylcarbamoyl)-2-bicyclo[2.2.1]hept-5-enyl]carbamate.
| Compound Name | benzyl N-[(2R,3R)-3-(dimethylcarbamoyl)-2-bicyclo[2.2.1]hept-5-enyl]carbamate |
|---|---|
| PubChem CID | 75507587 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | benzyl N-[(2R,3R)-3-(dimethylcarbamoyl)-2-bicyclo[2.2.1]hept-5-enyl]carbamate |
| SMILES | CN(C)C(=O)[C@@H]1C2C=CC(C2)[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H22N2O3/c1-20(2)17(21)15-13-8-9-14(10-13)16(15)19-18(22)23-11-12-6-4-3-5-7-12/h3-9,13-16H,10-11H2,1-2H3,(H,19,22)/t13?,14?,15-,16-/m1/s1 |
| InChIKey | DDBSNDMTCKPSDO-QDIHITRGSA-N |
| XLogP | 2.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|