C30H33N3O6 — CID 102080822
benzyl N-[3,5-bis(phenylmethoxycarbonylamino)cyclohexyl]carbamate (PubChem CID 102080822) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is benzyl N-[3,5-bis(phenylmethoxycarbonylamino)cyclohexyl]carbamate.
| Compound Name | benzyl N-[3,5-bis(phenylmethoxycarbonylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 102080822 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | benzyl N-[3,5-bis(phenylmethoxycarbonylamino)cyclohexyl]carbamate |
| SMILES | O=C(NC1CC(NC(=O)OCc2ccccc2)CC(NC(=O)OCc2ccccc2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C30H33N3O6/c34-28(37-19-22-10-4-1-5-11-22)31-25-16-26(32-29(35)38-20-23-12-6-2-7-13-23)18-27(17-25)33-30(36)39-21-24-14-8-3-9-15-24/h1-15,25-27H,16-21H2,(H,31,34)(H,32,35)(H,33,36) |
| InChIKey | PGSJPWVJKMIOJT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|