C12H17ClN2O2 — CID 122164408
benzyl N-(3-aminocyclobutyl)carbamate;hydrochloride (PubChem CID 122164408) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is benzyl N-(3-aminocyclobutyl)carbamate;hydrochloride.
| Compound Name | benzyl N-(3-aminocyclobutyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 122164408 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | benzyl N-(3-aminocyclobutyl)carbamate;hydrochloride |
| SMILES | Cl.NC1CC(NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C12H16N2O2.ClH/c13-10-6-11(7-10)14-12(15)16-8-9-4-2-1-3-5-9;/h1-5,10-11H,6-8,13H2,(H,14,15);1H |
| InChIKey | BGVPTTZDQSXFEP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |