C29H38N2O4 — CID 10345017
benzyl N-[4-[[4-(phenylmethoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate (PubChem CID 10345017) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is benzyl N-[4-[[4-(phenylmethoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[[4-(phenylmethoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 10345017 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | benzyl N-[4-[[4-(phenylmethoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate |
| SMILES | O=C(NC1CCC(CC2CCC(NC(=O)OCc3ccccc3)CC2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C29H38N2O4/c32-28(34-20-24-7-3-1-4-8-24)30-26-15-11-22(12-16-26)19-23-13-17-27(18-14-23)31-29(33)35-21-25-9-5-2-6-10-25/h1-10,22-23,26-27H,11-21H2,(H,30,32)(H,31,33) |
| InChIKey | IBBRIKFLHCSOTP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |