C21H20O2 — CID 11055843
benzyl (1S,2R,3R,4R)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11055843) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is benzyl (1S,2R,3R,4R)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | benzyl (1S,2R,3R,4R)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11055843 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | benzyl (1S,2R,3R,4R)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1[C@H](c2ccccc2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C21H20O2/c22-21(23-14-15-7-3-1-4-8-15)20-18-12-11-17(13-18)19(20)16-9-5-2-6-10-16/h1-12,17-20H,13-14H2/t17-,18+,19+,20+/m0/s1 |
| InChIKey | AABXDMMTIIJELG-MTQWCTHYSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|