C9H10AgO4 — CID 58884336
bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;silver (PubChem CID 58884336) has the molecular formula C9H10AgO4 and a molecular weight of 290.04 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;silver.
| Compound Name | bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;silver |
|---|---|
| PubChem CID | 58884336 |
| Molecular Formula | C9H10AgO4 |
| Molecular Weight | 290.04 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;silver |
| SMILES | O=C(O)C1C2C=CC(C2)C1C(=O)O.[Ag] |
| InChI | InChI=1S/C9H10O4.Ag/c10-8(11)6-4-1-2-5(3-4)7(6)9(12)13;/h1-2,4-7H,3H2,(H,10,11)(H,12,13); |
| InChIKey | BPKKUXRDMBYBGZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.04 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|