C10H10O5 — CID 88516165
bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;carbon monoxide (PubChem CID 88516165) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;carbon monoxide.
| Compound Name | bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;carbon monoxide |
|---|---|
| PubChem CID | 88516165 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;carbon monoxide |
| SMILES | O=C(O)C1C2C=CC(C2)C1C(=O)O.[C-]#[O+] |
| InChI | InChI=1S/C9H10O4.CO/c10-8(11)6-4-1-2-5(3-4)7(6)9(12)13;1-2/h1-2,4-7H,3H2,(H,10,11)(H,12,13); |
| InChIKey | MSGCPVYPOOHWGU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|