C13H14O8 — CID 90218986
bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid (PubChem CID 90218986) has the molecular formula C13H14O8 and a molecular weight of 298.25 g/mol. Its IUPAC name is bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid.
| Compound Name | bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid |
|---|---|
| PubChem CID | 90218986 |
| Molecular Formula | C13H14O8 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid |
| SMILES | O=C(O)C1CC2C=CC(C1C(=O)O)C(C(=O)O)C2C(=O)O |
| InChI | InChI=1S/C13H14O8/c14-10(15)6-3-4-1-2-5(8(6)12(18)19)9(13(20)21)7(4)11(16)17/h1-2,4-9H,3H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | LISMYBCXFVSIJR-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|