bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid

C13H14O8 — CID 90218986

IUPACbicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid
SMILESO=C(O)C1CC2C=CC(C1C(=O)O)C(C(=O)O)C2C(=O)O
InChIInChI=1S/C13H14O8/c14-10(15)6-3-4-1-2-5(8(6)12(18)19)9(13(20)21)7(4)11(16)17/h1-2,4-9H,3H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21)
InChIKeyLISMYBCXFVSIJR-UHFFFAOYSA-N
MW298.25 g/mol
LogP-0.00
Rot. Bonds4

About bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid

bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid (PubChem CID 90218986) has the molecular formula C13H14O8 and a molecular weight of 298.25 g/mol. Its IUPAC name is bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid.

Molecular Properties

Compound Namebicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid
PubChem CID90218986
Molecular FormulaC13H14O8
Molecular Weight298.25 g/mol
Exact Mass298.07
IUPAC Namebicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid
SMILESO=C(O)C1CC2C=CC(C1C(=O)O)C(C(=O)O)C2C(=O)O
InChIInChI=1S/C13H14O8/c14-10(15)6-3-4-1-2-5(8(6)12(18)19)9(13(20)21)7(4)11(16)17/h1-2,4-9H,3H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21)
InChIKeyLISMYBCXFVSIJR-UHFFFAOYSA-N
XLogP-0.00
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.25
LogP ≤ 5-0.00
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid?
The IUPAC name of bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid (CID 90218986) is bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid.
What is the SMILES notation for bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid?
The canonical SMILES for bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid is O=C(O)C1CC2C=CC(C1C(=O)O)C(C(=O)O)C2C(=O)O.
What is the InChIKey of bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid?
The InChIKey is LISMYBCXFVSIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O8/c14-10(15)6-3-4-1-2-5(8(6)12(18)19)9(13(20)21)7(4)11(16)17/h1-2,4-9H,3H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21).
What are the key properties of bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid?
bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid has a molecular weight of 298.25 g/mol, XLogP of -0.00, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.2.2]non-8-ene-2,3,6,7-tetracarboxylic acid is sourced from PubChem (CID 90218986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).