C9H10O5 — CID 20677737
7-hydroxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid (PubChem CID 20677737) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is 7-hydroxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid.
| Compound Name | 7-hydroxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 20677737 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 7-hydroxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| SMILES | O=C(O)C1C2C=CC(C2O)C1C(=O)O |
| InChI | InChI=1S/C9H10O5/c10-7-3-1-2-4(7)6(9(13)14)5(3)8(11)12/h1-7,10H,(H,11,12)(H,13,14) |
| InChIKey | GTEOJCGRHNHQRE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|