C24H22O7 — CID 21139698
8-(8-carboxytricyclo[4.2.2.02,5]deca-3,9-diene-7-carbonyl)oxycarbonyltricyclo[4.2.2.02,5]deca-3,9-diene-7-carboxylic acid (PubChem CID 21139698) has the molecular formula C24H22O7 and a molecular weight of 422.43 g/mol. Its IUPAC name is 8-(8-carboxytricyclo[4.2.2.02,5]deca-3,9-diene-7-carbonyl)oxycarbonyltricyclo[4.2.2.02,5]deca-3,9-diene-7-carboxylic acid.
| Compound Name | 8-(8-carboxytricyclo[4.2.2.02,5]deca-3,9-diene-7-carbonyl)oxycarbonyltricyclo[4.2.2.02,5]deca-3,9-diene-7-carboxylic acid |
|---|---|
| PubChem CID | 21139698 |
| Molecular Formula | C24H22O7 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 8-(8-carboxytricyclo[4.2.2.02,5]deca-3,9-diene-7-carbonyl)oxycarbonyltricyclo[4.2.2.02,5]deca-3,9-diene-7-carboxylic acid |
| SMILES | O=C(O)C1C2C=CC(C3C=CC32)C1C(=O)OC(=O)C1C2C=CC(C3C=CC32)C1C(=O)O |
| InChI | InChI=1S/C24H22O7/c25-21(26)17-13-5-7-15(11-3-1-9(11)13)19(17)23(29)31-24(30)20-16-8-6-14(18(20)22(27)28)10-2-4-12(10)16/h1-20H,(H,25,26)(H,27,28) |
| InChIKey | ITXWDBNJPBVXBU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|